cis-Dichloropeptide ester-platinum(II) complexes

Zusammenfassung

Peptide complexes I (R, R1 = H, C1-4 alkyl, optionally substituted by OH, NH2, OMe, OEt, SH, SMe, SEt, CH2Ph, CH2C6H4OH, CH2C6H4OMe, CH2C6H4OEt; R2 = C1-4 alkyl; n = 1-3) were prepd. Thus cis-PtCl2(Gly-OH)2 was treated with 4-O2NC6H4OH and cis-PtCl2(Gly-OC6H4NO2-4)2 treated with H-Gly-OEt to give cis-PtCl2(Gly-Gly-OEt)2 (I). I had a min. inhibitory concn. against Escherichia coli B of 5 * 10-4 mol/L and inhibited DNA synthesis in Walker 256 carcinosarcoma at 4.5 * 10-7 mol/L.